C22H33NO3 — CID 18117011
2-(5-acetyl-2-methoxyphenyl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide (PubChem CID 18117011) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 18117011 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)Cc2cc(C(C)=O)ccc2OC)CC1 |
| InChI | InChI=1S/C22H33NO3/c1-6-22(3,4)18-8-10-19(11-9-18)23-21(25)14-17-13-16(15(2)24)7-12-20(17)26-5/h7,12-13,18-19H,6,8-11,14H2,1-5H3,(H,23,25) |
| InChIKey | OPJGFHIOKLMKEJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |