C17H19ClN2O3S — CID 18119370
N-[2-[2-(2-chlorophenoxy)ethyl-methylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 18119370) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[2-[2-(2-chlorophenoxy)ethyl-methylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[2-(2-chlorophenoxy)ethyl-methylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18119370 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[2-[2-(2-chlorophenoxy)ethyl-methylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N(C)CCOc2ccccc2Cl)s1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-12-7-8-15(24-12)17(22)19-11-16(21)20(2)9-10-23-14-6-4-3-5-13(14)18/h3-8H,9-11H2,1-2H3,(H,19,22) |
| InChIKey | JPAFQDOZWGAPQD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |