About 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide
4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 18119524) has the molecular formula C13H14ClN3O2
and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 18119524 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(C)c(CNC(=O)c2cc(Cl)c[nH]2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-7-3-8(2)17-12(18)10(7)6-16-13(19)11-4-9(14)5-15-11/h3-5,15H,6H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | KDKOCQKQWZKLPJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide (CID 18119524) is 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide is Cc1cc(C)c(CNC(=O)c2cc(Cl)c[nH]2)c(=O)[nH]1.
What is the InChIKey of 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide?
The InChIKey is KDKOCQKQWZKLPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN3O2/c1-7-3-8(2)17-12(18)10(7)6-16-13(19)11-4-9(14)5-15-11/h3-5,15H,6H2,1-2H3,(H,16,19)(H,17,18).
What are the key properties of 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide?
4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide has a molecular weight of 279.73 g/mol, XLogP of 1.90, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 18119524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).