C17H16FN3O2 — CID 18119662
N-[2-(4-fluorophenoxy)ethyl]-N-methyl-1H-indazole-3-carboxamide (PubChem CID 18119662) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-N-methyl-1H-indazole-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-N-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 18119662 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-N-methyl-1H-indazole-3-carboxamide |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16FN3O2/c1-21(10-11-23-13-8-6-12(18)7-9-13)17(22)16-14-4-2-3-5-15(14)19-20-16/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | IVIFVQSGZYUFKQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |