C15H20N2O3 — CID 18120666
ethyl 4-benzamidopiperidine-1-carboxylate (PubChem CID 18120666) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl 4-benzamidopiperidine-1-carboxylate.
| Compound Name | ethyl 4-benzamidopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18120666 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl 4-benzamidopiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20N2O3/c1-2-20-15(19)17-10-8-13(9-11-17)16-14(18)12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3,(H,16,18) |
| InChIKey | TZVFTWUATZDEDP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |