C23H28ClN3O2 — CID 18121033
N-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-3-oxopropyl]-3-methylbenzamide (PubChem CID 18121033) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-3-oxopropyl]-3-methylbenzamide.
| Compound Name | N-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-3-oxopropyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 18121033 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-3-oxopropyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCC(=O)NC2CCN(Cc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-17-3-2-4-19(15-17)23(29)25-12-9-22(28)26-21-10-13-27(14-11-21)16-18-5-7-20(24)8-6-18/h2-8,15,21H,9-14,16H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | VSGSEOKCRSPOJQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |