C21H30ClN3O2 — CID 18121101
N-[2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 18121101) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-[2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18121101 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCCC1)NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H30ClN3O2/c22-18-8-6-16(7-9-18)15-25-12-10-19(11-13-25)24-20(26)14-23-21(27)17-4-2-1-3-5-17/h6-9,17,19H,1-5,10-15H2,(H,23,27)(H,24,26) |
| InChIKey | FHEIJGWDMOFZNF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |