C18H20N2O3 — CID 18122534
(1-anilino-1-oxobutan-2-yl) 2-amino-3-methylbenzoate (PubChem CID 18122534) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (1-anilino-1-oxobutan-2-yl) 2-amino-3-methylbenzoate.
| Compound Name | (1-anilino-1-oxobutan-2-yl) 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 18122534 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (1-anilino-1-oxobutan-2-yl) 2-amino-3-methylbenzoate |
| SMILES | CCC(OC(=O)c1cccc(C)c1N)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-3-15(17(21)20-13-9-5-4-6-10-13)23-18(22)14-11-7-8-12(2)16(14)19/h4-11,15H,3,19H2,1-2H3,(H,20,21) |
| InChIKey | XMDRPJFFAUTOEV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|