About N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide
N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide (PubChem CID 18123984) has the molecular formula C16H21N3OS2
and a molecular weight of 335.50 g/mol. Its IUPAC name is N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide.
Molecular Properties
| Compound Name | N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide |
| PubChem CID | 18123984 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide |
| SMILES | CC(Sc1ncnc2ccsc12)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H21N3OS2/c1-11(15(20)19-12-6-4-2-3-5-7-12)22-16-14-13(8-9-21-14)17-10-18-16/h8-12H,2-7H2,1H3,(H,19,20) |
| InChIKey | ZBGKFIOEXOCVLS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide?
The IUPAC name of N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide (CID 18123984) is N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide.
What is the SMILES notation for N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide?
The canonical SMILES for N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide is CC(Sc1ncnc2ccsc12)C(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide?
The InChIKey is ZBGKFIOEXOCVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS2/c1-11(15(20)19-12-6-4-2-3-5-7-12)22-16-14-13(8-9-21-14)17-10-18-16/h8-12H,2-7H2,1H3,(H,19,20).
What are the key properties of N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide?
N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide has a molecular weight of 335.50 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide is sourced from PubChem (CID 18123984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).