C16H21N3OS2 — CID 18123984
N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide (PubChem CID 18123984) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide.
| Compound Name | N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 18123984 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-cycloheptyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanamide |
| SMILES | CC(Sc1ncnc2ccsc12)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H21N3OS2/c1-11(15(20)19-12-6-4-2-3-5-7-12)22-16-14-13(8-9-21-14)17-10-18-16/h8-12H,2-7H2,1H3,(H,19,20) |
| InChIKey | ZBGKFIOEXOCVLS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |