C22H29N3O — CID 18124087
4-[[4-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 18124087) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-[[4-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 18124087 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 4-[[4-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | CC(C)=CC1C(C(=O)N2CCN(Cc3ccc(C#N)cc3)CC2)C1(C)C |
| InChI | InChI=1S/C22H29N3O/c1-16(2)13-19-20(22(19,3)4)21(26)25-11-9-24(10-12-25)15-18-7-5-17(14-23)6-8-18/h5-8,13,19-20H,9-12,15H2,1-4H3 |
| InChIKey | QMHPWKHMXRTMPX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|