About 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol
4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol (PubChem CID 18125115) has the molecular formula C21H20N2O2
and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol.
Molecular Properties
| Compound Name | 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol |
| PubChem CID | 18125115 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol |
| SMILES | Oc1ccc(C2=CCN(Cc3ncc(-c4ccccc4)o3)CC2)cc1 |
| InChI | InChI=1S/C21H20N2O2/c24-19-8-6-16(7-9-19)17-10-12-23(13-11-17)15-21-22-14-20(25-21)18-4-2-1-3-5-18/h1-10,14,24H,11-13,15H2 |
| InChIKey | LSEQBHRFOOROAN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol?
The IUPAC name of 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol (CID 18125115) is 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol.
What is the SMILES notation for 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol?
The canonical SMILES for 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol is Oc1ccc(C2=CCN(Cc3ncc(-c4ccccc4)o3)CC2)cc1.
What is the InChIKey of 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol?
The InChIKey is LSEQBHRFOOROAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O2/c24-19-8-6-16(7-9-19)17-10-12-23(13-11-17)15-21-22-14-20(25-21)18-4-2-1-3-5-18/h1-10,14,24H,11-13,15H2.
What are the key properties of 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol?
4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol has a molecular weight of 332.40 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]phenol is sourced from PubChem (CID 18125115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).