C18H32N4O4S — CID 18125988
8-tert-butyl-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 18125988) has the molecular formula C18H32N4O4S and a molecular weight of 400.55 g/mol. Its IUPAC name is 8-tert-butyl-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-tert-butyl-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18125988 |
| Molecular Formula | C18H32N4O4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 8-tert-butyl-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CN1CCN(S(C)(=O)=O)CC1)C2=O |
| InChI | InChI=1S/C18H32N4O4S/c1-17(2,3)14-5-7-18(8-6-14)15(23)22(16(24)19-18)13-20-9-11-21(12-10-20)27(4,25)26/h14H,5-13H2,1-4H3,(H,19,24) |
| InChIKey | SPYOHESLEIGFHF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|