C15H14N6O2S — CID 18127115
2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitroimidazo[1,2-a]pyridine (PubChem CID 18127115) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitroimidazo[1,2-a]pyridine.
| Compound Name | 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 18127115 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitroimidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1c(Sc2nnc(C3CC3)n2C2CC2)nc2ccccn12 |
| InChI | InChI=1S/C15H14N6O2S/c22-21(23)14-13(16-11-3-1-2-8-19(11)14)24-15-18-17-12(9-4-5-9)20(15)10-6-7-10/h1-3,8-10H,4-7H2 |
| InChIKey | OGJHWIAXEJSGHF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|