C15H20N2O4 — CID 18128445
[1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 3-methylfuran-2-carboxylate (PubChem CID 18128445) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is [1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 3-methylfuran-2-carboxylate.
| Compound Name | [1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 18128445 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 3-methylfuran-2-carboxylate |
| SMILES | Cc1ccoc1C(=O)OC(C)C(=O)NC(C)(C#N)C(C)C |
| InChI | InChI=1S/C15H20N2O4/c1-9(2)15(5,8-16)17-13(18)11(4)21-14(19)12-10(3)6-7-20-12/h6-7,9,11H,1-5H3,(H,17,18) |
| InChIKey | SPAYPUPVFIPOBT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |