About N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine
N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 18129399) has the molecular formula C11H16N6
and a molecular weight of 232.29 g/mol. Its IUPAC name is N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 18129399 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CN(c1ccc2nnnn2n1)C1CCCCC1 |
| InChI | InChI=1S/C11H16N6/c1-16(9-5-3-2-4-6-9)11-8-7-10-12-14-15-17(10)13-11/h7-9H,2-6H2,1H3 |
| InChIKey | DXSYWEBKGUTMAJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine (CID 18129399) is N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine is CN(c1ccc2nnnn2n1)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is DXSYWEBKGUTMAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6/c1-16(9-5-3-2-4-6-9)11-8-7-10-12-14-15-17(10)13-11/h7-9H,2-6H2,1H3.
What are the key properties of N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 232.29 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-methyltetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 18129399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).