About 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene
1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene (PubChem CID 18130) has the molecular formula C14H9Br2Cl3
and a molecular weight of 443.39 g/mol. Its IUPAC name is 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene |
| PubChem CID | 18130 |
| Molecular Formula | C14H9Br2Cl3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 439.81 |
| IUPAC Name | 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene |
| SMILES | ClC(Cl)(Cl)C(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9Br2Cl3/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H |
| InChIKey | YPWDDFGPYBIPBG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene?
The IUPAC name of 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene (CID 18130) is 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene.
What is the SMILES notation for 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene?
The canonical SMILES for 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene is ClC(Cl)(Cl)C(c1ccc(Br)cc1)c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene?
The InChIKey is YPWDDFGPYBIPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Br2Cl3/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H.
What are the key properties of 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene?
1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene has a molecular weight of 443.39 g/mol, XLogP of 6.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[1-(4-bromophenyl)-2,2,2-trichloroethyl]benzene is sourced from PubChem (CID 18130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).