C18H11FN2O2S — CID 18130479
4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-3-fluorobenzonitrile (PubChem CID 18130479) has the molecular formula C18H11FN2O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 18130479 |
| Molecular Formula | C18H11FN2O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CN2c3cccc4cccc(c34)S2(=O)=O)c(F)c1 |
| InChI | InChI=1S/C18H11FN2O2S/c19-15-9-12(10-20)7-8-14(15)11-21-16-5-1-3-13-4-2-6-17(18(13)16)24(21,22)23/h1-9H,11H2 |
| InChIKey | DPYVXWQUBIDNMF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |