C17H19N5O2S — CID 18132764
N-[4-(dimethylamino)phenyl]-2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 18132764) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 18132764 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CSc2nncn2Cc2ccco2)cc1 |
| InChI | InChI=1S/C17H19N5O2S/c1-21(2)14-7-5-13(6-8-14)19-16(23)11-25-17-20-18-12-22(17)10-15-4-3-9-24-15/h3-9,12H,10-11H2,1-2H3,(H,19,23) |
| InChIKey | PQGYYMQHAKXZTB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|