C17H23BrN4S — CID 18132987
2-[[(4-bromophenyl)methyl-methylamino]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione (PubChem CID 18132987) has the molecular formula C17H23BrN4S and a molecular weight of 395.37 g/mol. Its IUPAC name is 2-[[(4-bromophenyl)methyl-methylamino]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4-bromophenyl)methyl-methylamino]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18132987 |
| Molecular Formula | C17H23BrN4S |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[[(4-bromophenyl)methyl-methylamino]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione |
| SMILES | CC(C)c1nn(CN(C)Cc2ccc(Br)cc2)c(=S)n1C1CC1 |
| InChI | InChI=1S/C17H23BrN4S/c1-12(2)16-19-21(17(23)22(16)15-8-9-15)11-20(3)10-13-4-6-14(18)7-5-13/h4-7,12,15H,8-11H2,1-3H3 |
| InChIKey | HVIYCQHKVSXEQY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|