C21H17F2NO2 — CID 18133644
N-cyclopropyl-5-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]furan-2-carboxamide (PubChem CID 18133644) has the molecular formula C21H17F2NO2 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-cyclopropyl-5-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]furan-2-carboxamide.
| Compound Name | N-cyclopropyl-5-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18133644 |
| Molecular Formula | C21H17F2NO2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-cyclopropyl-5-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(c1ccc(-c2ccc(F)cc2)o1)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C21H17F2NO2/c22-16-5-1-14(2-6-16)13-24(18-9-10-18)21(25)20-12-11-19(26-20)15-3-7-17(23)8-4-15/h1-8,11-12,18H,9-10,13H2 |
| InChIKey | MLYPYXNCKQGXPS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |