C18H18N6S2 — CID 18133691
N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 18133691) has the molecular formula C18H18N6S2 and a molecular weight of 382.52 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18133691 |
| Molecular Formula | C18H18N6S2 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(-c3cccs3)nc(NCc3nnc4n3CCC4)c2c1C |
| InChI | InChI=1S/C18H18N6S2/c1-10-11(2)26-18-15(10)17(20-16(21-18)12-5-4-8-25-12)19-9-14-23-22-13-6-3-7-24(13)14/h4-5,8H,3,6-7,9H2,1-2H3,(H,19,20,21) |
| InChIKey | ZQHOYTZNISEGIM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |