About 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide
5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide (PubChem CID 18136016) has the molecular formula C12H9ClF3N3O
and a molecular weight of 303.67 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 18136016 |
| Molecular Formula | C12H9ClF3N3O |
| Molecular Weight | 303.67 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClF3N3O/c13-8-3-1-7(2-4-8)10-9(5-18-19-10)11(20)17-6-12(14,15)16/h1-5H,6H2,(H,17,20)(H,18,19) |
| InChIKey | FAICWDFRCRADML-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide (CID 18136016) is 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide is O=C(NCC(F)(F)F)c1cn[nH]c1-c1ccc(Cl)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
The InChIKey is FAICWDFRCRADML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3N3O/c13-8-3-1-7(2-4-8)10-9(5-18-19-10)11(20)17-6-12(14,15)16/h1-5H,6H2,(H,17,20)(H,18,19).
What are the key properties of 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide has a molecular weight of 303.67 g/mol, XLogP of 3.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 18136016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).