About 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide (PubChem CID 18136880) has the molecular formula C17H14FN3O2
and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide.
Molecular Properties
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide |
| PubChem CID | 18136880 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2F)o1)Nc1ccccn1 |
| InChI | InChI=1S/C17H14FN3O2/c18-13-6-2-1-5-12(13)14-11-20-17(23-14)9-8-16(22)21-15-7-3-4-10-19-15/h1-7,10-11H,8-9H2,(H,19,21,22) |
| InChIKey | BMULELCCJILYJY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide?
The IUPAC name of 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide (CID 18136880) is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide.
What is the SMILES notation for 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide?
The canonical SMILES for 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide is O=C(CCc1ncc(-c2ccccc2F)o1)Nc1ccccn1.
What is the InChIKey of 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide?
The InChIKey is BMULELCCJILYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O2/c18-13-6-2-1-5-12(13)14-11-20-17(23-14)9-8-16(22)21-15-7-3-4-10-19-15/h1-7,10-11H,8-9H2,(H,19,21,22).
What are the key properties of 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide?
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide has a molecular weight of 311.32 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-2-ylpropanamide is sourced from PubChem (CID 18136880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).