C22H23ClN4O — CID 18137864
N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-(2-phenylpyrrolidin-1-yl)acetamide (PubChem CID 18137864) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-(2-phenylpyrrolidin-1-yl)acetamide.
| Compound Name | N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-(2-phenylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 18137864 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-(2-phenylpyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCC1c1ccccc1)Nc1ccnn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H23ClN4O/c23-19-9-4-6-17(14-19)15-27-21(11-12-24-27)25-22(28)16-26-13-5-10-20(26)18-7-2-1-3-8-18/h1-4,6-9,11-12,14,20H,5,10,13,15-16H2,(H,25,28) |
| InChIKey | CSAHFBBQHCMHHQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |