About 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide
2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide (PubChem CID 18140232) has the molecular formula C11H14N4O3
and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide |
| PubChem CID | 18140232 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide |
| SMILES | CCn1cc(C#N)c(=O)n(CC(=O)N(C)C)c1=O |
| InChI | InChI=1S/C11H14N4O3/c1-4-14-6-8(5-12)10(17)15(11(14)18)7-9(16)13(2)3/h6H,4,7H2,1-3H3 |
| InChIKey | MSDPWZKWEAVZKL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide (CID 18140232) is 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide is CCn1cc(C#N)c(=O)n(CC(=O)N(C)C)c1=O.
What is the InChIKey of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide?
The InChIKey is MSDPWZKWEAVZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O3/c1-4-14-6-8(5-12)10(17)15(11(14)18)7-9(16)13(2)3/h6H,4,7H2,1-3H3.
What are the key properties of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide?
2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide has a molecular weight of 250.26 g/mol, XLogP of -1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 18140232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).