About 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide
2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide (PubChem CID 18140234) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide |
| PubChem CID | 18140234 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1c(=O)c(C#N)cn(CC)c1=O |
| InChI | InChI=1S/C13H18N4O3/c1-4-15(5-2)11(18)9-17-12(19)10(7-14)8-16(6-3)13(17)20/h8H,4-6,9H2,1-3H3 |
| InChIKey | KBWFCNZIAFNRTN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide?
The IUPAC name of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide (CID 18140234) is 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide.
What is the SMILES notation for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide?
The canonical SMILES for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide is CCN(CC)C(=O)Cn1c(=O)c(C#N)cn(CC)c1=O.
What is the InChIKey of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide?
The InChIKey is KBWFCNZIAFNRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3/c1-4-15(5-2)11(18)9-17-12(19)10(7-14)8-16(6-3)13(17)20/h8H,4-6,9H2,1-3H3.
What are the key properties of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide?
2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide has a molecular weight of 278.31 g/mol, XLogP of -0.23, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N,N-diethylacetamide is sourced from PubChem (CID 18140234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).