C21H23N3O4 — CID 18142226
3-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzoxazol-2-one (PubChem CID 18142226) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 18142226 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)C(C)n3c(=O)oc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-15(24-18-5-3-4-6-19(18)28-21(24)26)20(25)23-13-11-22(12-14-23)16-7-9-17(27-2)10-8-16/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | WSBGAESQADUMQB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|