About 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one
4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one (PubChem CID 18142402) has the molecular formula C20H25Cl2N3O3
and a molecular weight of 426.34 g/mol. Its IUPAC name is 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one |
| PubChem CID | 18142402 |
| Molecular Formula | C20H25Cl2N3O3 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one |
| SMILES | COc1cc(CCC2CCN(Cn3ncc(Cl)c(Cl)c3=O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C20H25Cl2N3O3/c1-27-16-9-15(10-17(11-16)28-2)4-3-14-5-7-24(8-6-14)13-25-20(26)19(22)18(21)12-23-25/h9-12,14H,3-8,13H2,1-2H3 |
| InChIKey | WAFGHYPQOKVAQE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one (CID 18142402) is 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one is COc1cc(CCC2CCN(Cn3ncc(Cl)c(Cl)c3=O)CC2)cc(OC)c1.
What is the InChIKey of 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one?
The InChIKey is WAFGHYPQOKVAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25Cl2N3O3/c1-27-16-9-15(10-17(11-16)28-2)4-3-14-5-7-24(8-6-14)13-25-20(26)19(22)18(21)12-23-25/h9-12,14H,3-8,13H2,1-2H3.
What are the key properties of 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one?
4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one has a molecular weight of 426.34 g/mol, XLogP of 3.87, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]methyl]pyridazin-3-one is sourced from PubChem (CID 18142402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).