C24H32N2O2 — CID 18142430
N-[2-(1-adamantyl)ethyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide (PubChem CID 18142430) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 18142430 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide |
| SMILES | O=C(CCC1Cc2ccccc2NC1=O)NCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O2/c27-22(6-5-20-12-19-3-1-2-4-21(19)26-23(20)28)25-8-7-24-13-16-9-17(14-24)11-18(10-16)15-24/h1-4,16-18,20H,5-15H2,(H,25,27)(H,26,28) |
| InChIKey | RXOSSPOVLHUCKV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |