C21H23N3O2S — CID 18142631
3'-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 18142631) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 3'-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 18142631 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3'-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCCc3ccccc32)C(=O)N1CN1CCc2sccc2C1 |
| InChI | InChI=1S/C21H23N3O2S/c25-19-21(10-4-3-6-15-5-1-2-7-17(15)21)22-20(26)24(19)14-23-11-8-18-16(13-23)9-12-27-18/h1-2,5,7,9,12H,3-4,6,8,10-11,13-14H2,(H,22,26) |
| InChIKey | FNMSYLCVISEOQT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|