About methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate
methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate (PubChem CID 18143028) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate |
| PubChem CID | 18143028 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)CCC1Cc2ccccc2NC1=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O4/c1-28-21(26)14-19(15-7-3-2-4-8-15)23-20(25)12-11-17-13-16-9-5-6-10-18(16)24-22(17)27/h2-10,17,19H,11-14H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | ZYMVGUBLOYVVCD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate?
The IUPAC name of methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate (CID 18143028) is methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate.
What is the SMILES notation for methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate?
The canonical SMILES for methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate is COC(=O)CC(NC(=O)CCC1Cc2ccccc2NC1=O)c1ccccc1.
What is the InChIKey of methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate?
The InChIKey is ZYMVGUBLOYVVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-28-21(26)14-19(15-7-3-2-4-8-15)23-20(25)12-11-17-13-16-9-5-6-10-18(16)24-22(17)27/h2-10,17,19H,11-14H2,1H3,(H,23,25)(H,24,27).
What are the key properties of methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate?
methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate has a molecular weight of 380.44 g/mol, XLogP of 3.00, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]-3-phenylpropanoate is sourced from PubChem (CID 18143028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).