C19H15NO5 — CID 18143517
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 18143517) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 18143517 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CC(NC(=O)c1cc2ccccc2oc1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15NO5/c1-11(12-6-7-16-17(9-12)24-10-23-16)20-18(21)14-8-13-4-2-3-5-15(13)25-19(14)22/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | XCPBCWQBIGXJPX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|