About octane-2-thiol
octane-2-thiol (PubChem CID 18145) has the molecular formula C8H18S
and a molecular weight of 146.30 g/mol. Its IUPAC name is octane-2-thiol.
Molecular Properties
| Compound Name | octane-2-thiol |
| PubChem CID | 18145 |
| Molecular Formula | C8H18S |
| Molecular Weight | 146.30 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | octane-2-thiol |
| SMILES | CCCCCCC(C)S |
| InChI | InChI=1S/C8H18S/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
| InChIKey | BZXFEMZFRLXGCY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze octane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-2-thiol?
The IUPAC name of octane-2-thiol (CID 18145) is octane-2-thiol.
What is the SMILES notation for octane-2-thiol?
The canonical SMILES for octane-2-thiol is CCCCCCC(C)S.
What is the InChIKey of octane-2-thiol?
The InChIKey is BZXFEMZFRLXGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18S/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3.
What are the key properties of octane-2-thiol?
octane-2-thiol has a molecular weight of 146.30 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octane-2-thiol is sourced from PubChem (CID 18145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).