About N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide
N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 18146543) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide.
Molecular Properties
| Compound Name | N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide |
| PubChem CID | 18146543 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2cnc3ccccc3c2)c(OC)c1OC |
| InChI | InChI=1S/C20H20N2O4/c1-24-17-9-8-14(19(25-2)20(17)26-3)11-18(23)22-15-10-13-6-4-5-7-16(13)21-12-15/h4-10,12H,11H2,1-3H3,(H,22,23) |
| InChIKey | MXTVVVCXVDKWPJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide?
The IUPAC name of N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide (CID 18146543) is N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide.
What is the SMILES notation for N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide?
The canonical SMILES for N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide is COc1ccc(CC(=O)Nc2cnc3ccccc3c2)c(OC)c1OC.
What is the InChIKey of N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide?
The InChIKey is MXTVVVCXVDKWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c1-24-17-9-8-14(19(25-2)20(17)26-3)11-18(23)22-15-10-13-6-4-5-7-16(13)21-12-15/h4-10,12H,11H2,1-3H3,(H,22,23).
What are the key properties of N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide?
N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide has a molecular weight of 352.39 g/mol, XLogP of 3.44, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-quinolin-3-yl-2-(2,3,4-trimethoxyphenyl)acetamide is sourced from PubChem (CID 18146543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).