C20H13N3O3 — CID 18147895
N-(3-ethynylphenyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 18147895) has the molecular formula C20H13N3O3 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 18147895 |
| Molecular Formula | C20H13N3O3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(3-ethynylphenyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc(-c3ccco3)nc3onc(C)c23)c1 |
| InChI | InChI=1S/C20H13N3O3/c1-3-13-6-4-7-14(10-13)21-19(24)15-11-16(17-8-5-9-25-17)22-20-18(15)12(2)23-26-20/h1,4-11H,2H3,(H,21,24) |
| InChIKey | CEDDEFXYCTUEGB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|