C16H18FNO4S2 — CID 18148535
methyl 3-[[1-(4-fluorophenyl)-2-methylpropyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 18148535) has the molecular formula C16H18FNO4S2 and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl 3-[[1-(4-fluorophenyl)-2-methylpropyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[1-(4-fluorophenyl)-2-methylpropyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18148535 |
| Molecular Formula | C16H18FNO4S2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | methyl 3-[[1-(4-fluorophenyl)-2-methylpropyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NC(c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C16H18FNO4S2/c1-10(2)14(11-4-6-12(17)7-5-11)18-24(20,21)13-8-9-23-15(13)16(19)22-3/h4-10,14,18H,1-3H3 |
| InChIKey | UFNWJYBJCPTFJK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |