About 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one
1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one (PubChem CID 18149120) has the molecular formula C17H16F2N2O4S
and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
| PubChem CID | 18149120 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
| SMILES | O=C(Cn1cc(S(=O)(=O)N2CCCC2)ccc1=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H16F2N2O4S/c18-14-5-3-12(9-15(14)19)16(22)11-20-10-13(4-6-17(20)23)26(24,25)21-7-1-2-8-21/h3-6,9-10H,1-2,7-8,11H2 |
| InChIKey | BLQCUCZNNTXSLT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one?
The IUPAC name of 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one (CID 18149120) is 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one.
What is the SMILES notation for 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one?
The canonical SMILES for 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one is O=C(Cn1cc(S(=O)(=O)N2CCCC2)ccc1=O)c1ccc(F)c(F)c1.
What is the InChIKey of 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one?
The InChIKey is BLQCUCZNNTXSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N2O4S/c18-14-5-3-12(9-15(14)19)16(22)11-20-10-13(4-6-17(20)23)26(24,25)21-7-1-2-8-21/h3-6,9-10H,1-2,7-8,11H2.
What are the key properties of 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one?
1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one has a molecular weight of 382.39 g/mol, XLogP of 1.79, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one is sourced from PubChem (CID 18149120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).