C23H25N3O4 — CID 18149429
2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]acetamide (PubChem CID 18149429) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 18149429 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)NC1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H25N3O4/c1-16(27)26-13-8-17-5-2-3-6-19(17)20(26)15-22(28)24-18-9-11-25(12-10-18)23(29)21-7-4-14-30-21/h2-8,13-14,18,20H,9-12,15H2,1H3,(H,24,28) |
| InChIKey | BUHMPAJTNPGFDE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |