About (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one
(3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one (PubChem CID 18149927) has the molecular formula C18H15BrO4
and a molecular weight of 375.22 g/mol. Its IUPAC name is (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one.
Molecular Properties
| Compound Name | (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one |
| PubChem CID | 18149927 |
| Molecular Formula | C18H15BrO4 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one |
| SMILES | COc1ccc(/C=C2\COc3ccc(Br)cc3C2=O)cc1OC |
| InChI | InChI=1S/C18H15BrO4/c1-21-16-5-3-11(8-17(16)22-2)7-12-10-23-15-6-4-13(19)9-14(15)18(12)20/h3-9H,10H2,1-2H3/b12-7+ |
| InChIKey | FNYARVHDBGPTJS-KPKJPENVSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one?
The IUPAC name of (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one (CID 18149927) is (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one.
What is the SMILES notation for (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one?
The canonical SMILES for (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one is COc1ccc(/C=C2\COc3ccc(Br)cc3C2=O)cc1OC.
What is the InChIKey of (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one?
The InChIKey is FNYARVHDBGPTJS-KPKJPENVSA-N. The full InChI is InChI=1S/C18H15BrO4/c1-21-16-5-3-11(8-17(16)22-2)7-12-10-23-15-6-4-13(19)9-14(15)18(12)20/h3-9H,10H2,1-2H3/b12-7+.
What are the key properties of (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one?
(3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one has a molecular weight of 375.22 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-bromo-3-[(3,4-dimethoxyphenyl)methylidene]chromen-4-one is sourced from PubChem (CID 18149927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).