C19H17Cl2N3O — CID 18149973
2-[[benzhydryl(methyl)amino]methyl]-4,5-dichloropyridazin-3-one (PubChem CID 18149973) has the molecular formula C19H17Cl2N3O and a molecular weight of 374.27 g/mol. Its IUPAC name is 2-[[benzhydryl(methyl)amino]methyl]-4,5-dichloropyridazin-3-one.
| Compound Name | 2-[[benzhydryl(methyl)amino]methyl]-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 18149973 |
| Molecular Formula | C19H17Cl2N3O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[[benzhydryl(methyl)amino]methyl]-4,5-dichloropyridazin-3-one |
| SMILES | CN(Cn1ncc(Cl)c(Cl)c1=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17Cl2N3O/c1-23(13-24-19(25)17(21)16(20)12-22-24)18(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12,18H,13H2,1H3 |
| InChIKey | BHIZMHXYYNSPGV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |