C13H23N5O2 — CID 18150151
2,2,6,6-tetramethyl-N-(3-methyl-5-nitroimidazol-4-yl)piperidin-4-amine (PubChem CID 18150151) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-(3-methyl-5-nitroimidazol-4-yl)piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-(3-methyl-5-nitroimidazol-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 18150151 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-(3-methyl-5-nitroimidazol-4-yl)piperidin-4-amine |
| SMILES | Cn1cnc([N+](=O)[O-])c1NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H23N5O2/c1-12(2)6-9(7-13(3,4)16-12)15-11-10(18(19)20)14-8-17(11)5/h8-9,15-16H,6-7H2,1-5H3 |
| InChIKey | GIORNUFIYSXNGV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|