C22H28N4O — CID 18150595
4-(benzimidazol-1-yl)-N-[2-[di(propan-2-yl)amino]ethyl]benzamide (PubChem CID 18150595) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-[2-[di(propan-2-yl)amino]ethyl]benzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-[2-[di(propan-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 18150595 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-[2-[di(propan-2-yl)amino]ethyl]benzamide |
| SMILES | CC(C)N(CCNC(=O)c1ccc(-n2cnc3ccccc32)cc1)C(C)C |
| InChI | InChI=1S/C22H28N4O/c1-16(2)25(17(3)4)14-13-23-22(27)18-9-11-19(12-10-18)26-15-24-20-7-5-6-8-21(20)26/h5-12,15-17H,13-14H2,1-4H3,(H,23,27) |
| InChIKey | ZQEVUPWSBYZMLK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |