C20H34N4O4 — CID 18150685
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]butanamide (PubChem CID 18150685) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]butanamide.
| Compound Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]butanamide |
|---|---|
| PubChem CID | 18150685 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]butanamide |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)NCC2(N3CCOCC3)CCCCC2)C1=O |
| InChI | InChI=1S/C20H34N4O4/c1-19(2)17(26)24(18(27)22-19)10-6-7-16(25)21-15-20(8-4-3-5-9-20)23-11-13-28-14-12-23/h3-15H2,1-2H3,(H,21,25)(H,22,27) |
| InChIKey | HDAFALQZEAGDOF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|