C12H14F3N5O2 — CID 18151039
3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-methoxypropanamide (PubChem CID 18151039) has the molecular formula C12H14F3N5O2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-methoxypropanamide.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-methoxypropanamide |
|---|---|
| PubChem CID | 18151039 |
| Molecular Formula | C12H14F3N5O2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-methoxypropanamide |
| SMILES | CONC(=O)CCc1c(C)nc2nc(C(F)(F)F)nn2c1C |
| InChI | InChI=1S/C12H14F3N5O2/c1-6-8(4-5-9(21)19-22-3)7(2)20-11(16-6)17-10(18-20)12(13,14)15/h4-5H2,1-3H3,(H,19,21) |
| InChIKey | RANVUGWZLHOOBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|