C13H15N5O2S — CID 18151396
N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 18151396) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 18151396 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)CN3CCSC3=O)cc12 |
| InChI | InChI=1S/C13H15N5O2S/c1-8-10-5-9(6-14-12(10)17(2)16-8)15-11(19)7-18-3-4-21-13(18)20/h5-6H,3-4,7H2,1-2H3,(H,15,19) |
| InChIKey | SFEIIKGOFVLFKG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|