C21H38N4O3 — CID 18152212
3-(cyclohexylcarbamoylamino)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 18152212) has the molecular formula C21H38N4O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-(cyclohexylcarbamoylamino)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
| Compound Name | 3-(cyclohexylcarbamoylamino)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 18152212 |
| Molecular Formula | C21H38N4O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 3-(cyclohexylcarbamoylamino)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | O=C(CCNC(=O)NC1CCCCC1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H38N4O3/c26-19(9-12-22-20(27)24-18-7-3-1-4-8-18)23-17-21(10-5-2-6-11-21)25-13-15-28-16-14-25/h18H,1-17H2,(H,23,26)(H2,22,24,27) |
| InChIKey | HPADXRCVZFCHBS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |