C20H17FN2OS — CID 18153619
N-[(3-fluoro-4-methylphenyl)methyl]-2-phenylsulfanylpyridine-3-carboxamide (PubChem CID 18153619) has the molecular formula C20H17FN2OS and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-2-phenylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-2-phenylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 18153619 |
| Molecular Formula | C20H17FN2OS |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-2-phenylsulfanylpyridine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cccnc2Sc2ccccc2)cc1F |
| InChI | InChI=1S/C20H17FN2OS/c1-14-9-10-15(12-18(14)21)13-23-19(24)17-8-5-11-22-20(17)25-16-6-3-2-4-7-16/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | DXIYBIXVHYHLDN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |