C15H15N3O4 — CID 18155533
N-[(2-methoxy-4-pyridinyl)methyl]-3-methyl-4-nitrobenzamide (PubChem CID 18155533) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[(2-methoxy-4-pyridinyl)methyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 18155533 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-methyl-4-nitrobenzamide |
| SMILES | COc1cc(CNC(=O)c2ccc([N+](=O)[O-])c(C)c2)ccn1 |
| InChI | InChI=1S/C15H15N3O4/c1-10-7-12(3-4-13(10)18(20)21)15(19)17-9-11-5-6-16-14(8-11)22-2/h3-8H,9H2,1-2H3,(H,17,19) |
| InChIKey | PJDQJGCIRFKUCS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|