C15H13N3OS — CID 18155731
N-(4-methyl-2-pyridinyl)-3-pyrrol-1-ylthiophene-2-carboxamide (PubChem CID 18155731) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-3-pyrrol-1-ylthiophene-2-carboxamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-3-pyrrol-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18155731 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-3-pyrrol-1-ylthiophene-2-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2sccc2-n2cccc2)c1 |
| InChI | InChI=1S/C15H13N3OS/c1-11-4-6-16-13(10-11)17-15(19)14-12(5-9-20-14)18-7-2-3-8-18/h2-10H,1H3,(H,16,17,19) |
| InChIKey | IKZCRSNMKVEGTG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |