C16H17N3O3 — CID 18158423
3,5-dimethyl-N-[2-(prop-2-enylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide (PubChem CID 18158423) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(prop-2-enylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-[2-(prop-2-enylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 18158423 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3,5-dimethyl-N-[2-(prop-2-enylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1c(C)noc1C |
| InChI | InChI=1S/C16H17N3O3/c1-4-9-17-15(20)12-7-5-6-8-13(12)18-16(21)14-10(2)19-22-11(14)3/h4-8H,1,9H2,2-3H3,(H,17,20)(H,18,21) |
| InChIKey | ZVXHUYJCSFRJHF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|